Benzeneacetonitrile, 4-hydroxy-3,5-dimethoxy- - Names and Identifiers
Name | 3,5-Dimethoxy-4-hydroxyphenylacetonitrile
|
Synonyms | 3,5-Dimethoxy-4-hydroxyphenylacetonitrile 3,5-DIMETHOXY-4-HYDROXYPHENYL ACETONITRILE (4-hydroxy-3,5-dimethoxyphenyl)acetonitrile 2-(4-hydroxy-3,5-dimethoxyphenyl)acetonitrile (4-Hydroxy-3,5-dimethoxy-phenyl)-acetonitrile Benzeneacetonitrile, 4-hydroxy-3,5-dimethoxy-
|
CAS | 42973-55-7
|
InChI | InChI=1/C10H11NO3/c1-13-8-5-7(3-4-11)6-9(14-2)10(8)12/h5-6,12H,3H2,1-2H3 |
Benzeneacetonitrile, 4-hydroxy-3,5-dimethoxy- - Physico-chemical Properties
Molecular Formula | C10H11NO3
|
Molar Mass | 193.2 |
Density | 1.192g/cm3 |
Melting Point | 68-70°C |
Boling Point | 361.1°C at 760 mmHg |
Flash Point | 172.2°C |
Vapor Presure | 1.02E-05mmHg at 25°C |
Storage Condition | Room Temprature |
Refractive Index | 1.541 |
Benzeneacetonitrile, 4-hydroxy-3,5-dimethoxy- - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Hazard Class | IRRITANT, IRRITANT-H |
Benzeneacetonitrile, 4-hydroxy-3,5-dimethoxy- - Introduction
3, is an organic compound whose molecular formula is C10H11NO3.
Nature:
3, is a solid substance, usually white crystals or crystalline powder. It is soluble in water at room temperature and has a certain solubility. Its solubility is also affected by factors such as temperature, solvent properties and concentration. The compounds are soluble in polar solvents such as ethanol and dimethyl sulfoxide.
Use:
3, is often used as an intermediate in organic synthesis. It can be used to synthesize various important organic compounds, such as drugs and pesticides. Because it has multiple functional groups and can carry out different chemical reactions, it has been widely used in the synthesis of complex molecular structures.
Preparation Method:
Usually 3,5-dimethoxy-4-hydroxyphenylethaldehyde can be synthesized by reacting 3,5-dimethoxy-4-hydroxyphenylethaldehyde with hydrogen to synthesize cyanic acid. The reaction is generally carried out under acidic conditions, usually using an acid catalyst.
Safety Information:
In general, 3. It is relatively safe under the conditions of correct use and storage. However, it is still an organic compound, so appropriate protective measures should be taken when involved in handling and handling, such as wearing protective glasses, gloves and laboratory coats. When performing the procedure, avoid inhaling, swallowing or touching the compound. In case of accidental contact, rinse immediately with plenty of water and seek medical help. Please follow the relevant safety procedures during use.
Last Update:2024-04-09 21:04:16